CymitQuimica logo

CAS 871709-90-9

:

1H-Indazole-3,6-diamine

Description:
1H-Indazole-3,6-diamine, with the CAS number 871709-90-9, is a heterocyclic organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features amino groups at the 3 and 6 positions of the indazole ring, contributing to its potential reactivity and biological activity. It is typically a crystalline solid and may exhibit solubility in polar solvents due to the presence of the amino groups. The compound is of interest in medicinal chemistry and drug development, as indazole derivatives have been studied for their pharmacological properties, including anti-inflammatory and anticancer activities. Its molecular structure allows for various modifications, which can enhance its biological efficacy or alter its physicochemical properties. Safety and handling precautions should be observed, as with any chemical substance, and its stability under different conditions should be evaluated for practical applications.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,8H2,(H3,9,10,11)
SMILES:c1cc2c(cc1N)[nH][nH]c2=N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.