CymitQuimica logo

CAS 87171-21-9

:

5-ethyl-5-(1-ethylpropyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

Description:
5-ethyl-5-(1-ethylpropyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, with the CAS number 87171-21-9, is a chemical compound that belongs to the class of thioxodihydropyrimidines. This compound features a pyrimidine ring with a thioxo group, which contributes to its reactivity and potential biological activity. The presence of ethyl and 1-ethylpropyl substituents indicates that it has a branched alkyl structure, which can influence its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as antimicrobial or antifungal activity, making them of interest in pharmaceutical research. The thioxo group can also participate in various chemical reactions, potentially leading to the formation of derivatives with enhanced or altered properties. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its characteristics and potential applications in medicinal chemistry.
Formula:C11H18N2O2S
InChI:InChI=1/C11H18N2O2S/c1-4-7(5-2)11(6-3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)
SMILES:CCC(CC)C1(CC)C(=NC(=S)N=C1O)O
Synonyms:
  • 4,6(1H,5H)-pyrimidinedione, 5-ethyl-5-(1-ethylpropyl)dihydro-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.