CAS 87172-53-0
:alpha-D-mannoheptose
Description:
Alpha-D-mannoheptose is a seven-carbon sugar, specifically a heptose, that belongs to the class of monosaccharides. It is an aldohexose, meaning it contains an aldehyde group and has a specific configuration that classifies it as an epimer of D-mannose. This compound is characterized by its cyclic structure, typically existing in a pyranose form, which is a six-membered ring. Alpha-D-mannoheptose is soluble in water and exhibits a sweet taste, common to many sugars. It plays a significant role in various biological processes, particularly in the structure of certain polysaccharides and glycoproteins, contributing to the cell wall integrity of some bacteria. Its CAS number, 87172-53-0, is a unique identifier that helps in the cataloging and identification of this chemical substance in scientific literature and databases. The study of alpha-D-mannoheptose is important in fields such as biochemistry and microbiology, where it may be involved in cell signaling and interactions.
Formula:C7H14O7
InChI:InChI=1/C7H14O7/c8-1-2(9)6-4(11)3(10)5(12)7(13)14-6/h2-13H,1H2/t2-,3+,4-,5-,6+,7?/m1/s1
Synonyms:- D-glycero-L-altro-heptopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
