CAS 87172-82-5
:(2R,3R)-2-(Benzoyloxy)-3-hydroxybutanedioic acid
Description:
(2R,3R)-2-(Benzoyloxy)-3-hydroxybutanedioic acid, with the CAS number 87172-82-5, is a chiral compound characterized by its specific stereochemistry at the 2 and 3 positions of the butanedioic acid backbone. This substance features a benzoyloxy group, which enhances its solubility and reactivity, making it useful in various chemical applications. The presence of both hydroxyl and carboxylic acid functional groups contributes to its potential as a versatile intermediate in organic synthesis. The compound is likely to exhibit polar characteristics due to these functional groups, influencing its interactions in biological systems and chemical reactions. Additionally, its chirality may impart unique properties in enantioselective reactions, making it of interest in pharmaceutical chemistry. The stability of the compound under standard conditions and its reactivity with nucleophiles or electrophiles can be influenced by the steric and electronic effects of the benzoyloxy substituent. Overall, this compound's structural features suggest potential applications in medicinal chemistry and organic synthesis.
Formula:C11H10O7
InChI:InChI=1S/C11H10O7/c12-7(9(13)14)8(10(15)16)18-11(17)6-4-2-1-3-5-6/h1-5,7-8,12H,(H,13,14)(H,15,16)/t7-,8-/m1/s1
InChI key:InChIKey=JXXURQWKKCNUBH-HTQZYQBOSA-N
SMILES:[C@@H](OC(=O)C1=CC=CC=C1)([C@H](C(O)=O)O)C(O)=O
Synonyms:- Butanedioic acid, 2-(benzoyloxy)-3-hydroxy-, [R-(R*,R*)]-
- Butanedioic acid, 2-(benzoyloxy)-3-hydroxy-, (2R,3R)-
- (2R,3R)-2-(Benzoyloxy)-3-hydroxybutanedioic acid
- Rotigotine Impurity 14
- Rotigotine Impurity 28
- Ramipril Impurity 18
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
