CymitQuimica logo

CAS 871725-95-0

:

bromo-[2-(1,3-dioxan-2-yl)phenyl]magnesium

Description:
Bromo-[2-(1,3-dioxan-2-yl)phenyl]magnesium is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. This compound features a bromine atom attached to a phenyl group, which is further substituted with a 1,3-dioxane moiety, contributing to its unique chemical properties. Grignard reagents are known for their ability to act as nucleophiles, allowing them to react with electrophiles to form carbon-carbon bonds, making them invaluable in the synthesis of alcohols, ketones, and other organic compounds. The presence of the dioxane ring may influence the solubility and reactivity of the compound, potentially affecting its behavior in various solvents. Additionally, the magnesium atom in the structure plays a crucial role in stabilizing the negative charge associated with the carbon atom bonded to it, facilitating the reagent's reactivity. As with all Grignard reagents, care must be taken when handling this compound, as it is highly reactive with moisture and can ignite in the presence of water or air.
Formula:C10H11BrMgO2
InChI:InChI=1/C10H11O2.BrH.Mg/c1-2-5-9(6-3-1)10-11-7-4-8-12-10;;/h1-3,5,10H,4,7-8H2;1H;/q;;+1/p-1/rC10H11BrMgO2/c11-12-9-5-2-1-4-8(9)10-13-6-3-7-14-10/h1-2,4-5,10H,3,6-7H2
SMILES:c1ccc(cc1)C1OCCCO1.Br.[Mg]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.