CAS 87173-03-3
:S-[2,3-bis(hexadecanoyloxy)propyl]-N-hexadecanoyl-L-cysteinyl-L-seryl-L-seryl-L-asparaginyl-L-alanine
Description:
S-[2,3-bis(hexadecanoyloxy)propyl]-N-hexadecanoyl-L-cysteinyl-L-seryl-L-seryl-L-asparaginyl-L-alanine, with CAS number 87173-03-3, is a complex amphiphilic molecule characterized by its long hydrophobic fatty acid chains and hydrophilic amino acid residues. This structure allows it to interact with both lipid and aqueous environments, making it potentially useful in drug delivery systems and as a surfactant. The presence of multiple amino acids, including cysteine, serine, asparagine, and alanine, contributes to its biological activity and potential for forming stable aggregates or micelles in solution. The hexadecanoyloxy groups enhance its lipophilicity, promoting membrane interactions. Additionally, the molecule's unique composition may facilitate specific interactions with biological membranes or proteins, which could be leveraged in therapeutic applications. Overall, its amphiphilic nature and structural complexity suggest a versatile role in biochemical and pharmaceutical contexts, particularly in formulations aimed at enhancing solubility and bioavailability of hydrophobic compounds.
Formula:C67H124N6O14S
InChI:InChI=1/C67H124N6O14S/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-60(77)70-58(66(83)73-57(49-75)65(82)72-56(48-74)64(81)71-55(47-59(68)76)63(80)69-53(4)67(84)85)52-88-51-54(87-62(79)46-43-40-37-34-31-28-25-22-19-16-13-10-7-3)50-86-61(78)45-42-39-36-33-30-27-24-21-18-15-12-9-6-2/h53-58,74-75H,5-52H2,1-4H3,(H2,68,76)(H,69,80)(H,70,77)(H,71,81)(H,72,82)(H,73,83)(H,84,85)/t53-,54?,55-,56-,57-,58-/m0/s1
SMILES:CCCCCCCCCCCCCCCC(=N[C@@H](CSCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=N[C@@H](CO)C(=N[C@@H](CO)C(=N[C@@H](CC(=N)O)C(=N[C@@H](C)C(=O)O)O)O)O)O)O
Synonyms:- Pam3-Cys-Ser-Ser-Asn-Ala-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tripalmitoyl pentapeptide
CAS:<p>Tripalmitoyl pentapeptide is a Mitogen from E Coli lipoprotein. It also is a potent macrophage B lymphocyte activator.</p>Formula:C67H124N6O14SPurity:98%Color and Shape:SolidMolecular weight:1269.8Mitogenic Pentapeptide Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ser-Ser-Asn-Ala-OH
CAS:<p>Mitogenic Pentapeptide Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ser-Ser-Asn-Ala-OH is a synthetic pentapeptide that can be used to induce cell proliferation and antibody production. This peptide has been used in clinical trials with regulatory approval for use in humans. It has been shown to promote antibody response in animal experiments and to be active against tumor cells in tissue culture and cell cultures. Mitogenic Pentapeptide Palmitoyl-Cys((RS)-2,3-di(palmitoyloxy)-propyl)-Ser-Ser-Asn-Ala-OH also activated the monoclonal antibodies produced by hybridoma cells.</p>Formula:C67H124N6O14SPurity:Min. 95%Molecular weight:1,269.8 g/molMitogenic Pentapeptide
CAS:<p>The palmitoylated pentapeptide Pam3Cys-Ser-Ser-Asn-Ala represents a potent activator for monocytes/macrophages and B lymphocytes.</p>Formula:C67H124N6O14SPurity:98%Molecular weight:1269.82


