CAS 87178-63-0
:leu-pro hydrochloride
Description:
Leu-Pro hydrochloride, with the CAS number 87178-63-0, is a synthetic dipeptide composed of the amino acids leucine and proline. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various biochemical applications. This compound is often utilized in research and pharmaceutical contexts, particularly in studies related to protein synthesis and metabolic processes. Leu-Pro hydrochloride may exhibit properties such as stability under physiological conditions and potential bioactivity, which can influence cellular functions. Its molecular structure allows it to participate in various biochemical pathways, making it of interest in fields such as nutrition, pharmacology, and biochemistry. Additionally, like many peptides, it may have specific roles in signaling or as precursors to larger biomolecules. Safety and handling precautions should be observed, as with any chemical substance, to mitigate any potential risks associated with its use.
Formula:C11H21ClN2O3
InChI:InChI=1/C11H20N2O3.ClH/c1-7(2)6-8(12)10(14)13-5-3-4-9(13)11(15)16;/h7-9H,3-6,12H2,1-2H3,(H,15,16);1H
SMILES:CC(C)CC(C(=O)N1CCCC1C(=O)O)N.Cl
Synonyms:- H-Leu-Pro-OH . HCl
- Leucylproline Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
H-Leu-Pro-OH · HCl
CAS:Substrate for skin fibroblast prolidase.Formula:C11H20N2O3·HClPurity:> 99%Color and Shape:White PowderMolecular weight:264.75Leucylproline (hydrochloride)
CAS:Leucylproline (hydrochloride)Purity:≥95%Molecular weight:264.75g/molLeucylproline hydrochloride
CAS:Leucylproline hydrochloride is a dipeptide that acts as an exogenous peptide to regulate the synthesis of protease in Lactococcus lactis.Formula:C11H21ClN2O3Color and Shape:SolidMolecular weight:264.749(S)-1-((S)-2-Amino-4-methylpentanoyl)pyrrolidine-2-carboxylic acid hydrochloride
CAS:Purity:98%Molecular weight:264.75(S)-1-((S)-2-Amino-4-methylpentanoyl)pyrrolidine-2-carboxylic Acid Hydrochloride
CAS:Controlled ProductFormula:C11H20N2O3·HClColor and Shape:NeatMolecular weight:264.749H-Leu-Pro-OH hydrochloride
CAS:Please enquire for more information about H-Leu-Pro-OH hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H20N2O3•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:264.75 g/mol







