
CAS 871825-55-7
:N-Methyl-4-(1H-1,2,4-triazol-1-ylmethyl)benzenemethanamine
Description:
N-Methyl-4-(1H-1,2,4-triazol-1-ylmethyl)benzenemethanamine, identified by its CAS number 871825-55-7, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its aromatic amine structure, which includes a benzene ring substituted with a methyl group and a triazole moiety. The presence of the triazole group suggests potential biological activity, as triazoles are often found in pharmaceuticals and agrochemicals due to their ability to interact with biological systems. The compound may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, the methyl group attached to the nitrogen atom can affect the compound's lipophilicity and overall pharmacokinetic profile. Overall, N-Methyl-4-(1H-1,2,4-triazol-1-ylmethyl)benzenemethanamine is of interest in medicinal chemistry and may have applications in drug development or as a research tool in various biochemical studies.
Formula:C11H14N4
InChI:InChI=1S/C11H14N4/c1-12-6-10-2-4-11(5-3-10)7-15-9-13-8-14-15/h2-5,8-9,12H,6-7H2,1H3
InChI key:InChIKey=WYIDLXUVRHMPEI-UHFFFAOYSA-N
SMILES:C(C1=CC=C(CNC)C=C1)N2C=NC=N2
Synonyms:- N-Methyl-4-(1H-1,2,4-triazol-1-ylmethyl)benzenemethanamine
- Benzenemethanamine, N-methyl-4-(1H-1,2,4-triazol-1-ylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.