CAS 871825-60-4

N-methyl-1-[3-(pyridin-2-yloxy)phenyl]methanamine

Description:

N-methyl-1-[3-(pyridin-2-yloxy)phenyl]methanamine, with the CAS number 871825-60-4, is a chemical compound characterized by its complex structure that includes a methanamine core substituted with a pyridin-2-yloxy group and a phenyl ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the pyridine moiety may impart additional characteristics, such as potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its specific applications may vary, but it is often explored in the context of drug development or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1/C13H14N2O/c1-14-10-11-5-4-6-12(9-11)16-13-7-2-3-8-15-13/h2-9,14H,10H2,1H3

SMILES: CNCc1cccc(c1)Oc1ccccn1

Synonyms:

• N-methyl-N-[3-(pyridin-2-yloxy)benzyl]amine