CAS 871825-61-5
:5-(1,3-Dioxolan-2-yl)-2-thiophenesulfonyl chloride
Description:
5-(1,3-Dioxolan-2-yl)-2-thiophenesulfonyl chloride is a chemical compound characterized by its unique structure, which includes a thiophene ring and a dioxolane moiety. This compound features a sulfonyl chloride functional group, making it a reactive species often used in organic synthesis. The presence of the dioxolane ring contributes to its stability and solubility in various organic solvents. Typically, sulfonyl chlorides are known for their ability to act as electrophiles in nucleophilic substitution reactions, facilitating the introduction of sulfonyl groups into other molecules. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals due to its functional versatility. Additionally, its reactivity can be harnessed in coupling reactions or as a building block in the development of more complex chemical entities. Safety precautions should be observed when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines.
Formula:C7H7ClO4S2
InChI:InChI=1S/C7H7ClO4S2/c8-14(9,10)6-2-1-5(13-6)7-11-3-4-12-7/h1-2,7H,3-4H2
InChI key:InChIKey=FXLSSUOFGGIMFF-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(=CC1)C2OCCO2
Synonyms:- 5-(1,3-Dioxolan-2-yl)-2-thiophenesulfonyl chloride
- 2-Thiophenesulfonyl chloride, 5-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(1,3-Dioxolan-2-yl)thiophene-2-sulphonyl chloride
CAS:5-(1,3-Dioxolan-2-yl)thiophene-2-sulphonyl chloridePurity:techMolecular weight:254.71g/mol
