CymitQuimica logo

CAS 871829-90-2

:

Boronic acid, [4-(cyclopropyloxy)phenyl]-

Description:
Boronic acid, [4-(cyclopropyloxy)phenyl]- (CAS 871829-90-2) is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a cyclopropyloxy substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyclopropyloxy group introduces unique steric and electronic effects, potentially influencing the compound's reactivity and solubility. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this compound may exhibit interesting biological activities, making it a candidate for further research in drug development. Its stability, solubility in organic solvents, and reactivity with other functional groups are essential characteristics that define its utility in chemical synthesis and potential applications in pharmaceuticals.
Formula:C9H11BO3
InChI:InChI=1S/C9H11BO3/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9/h1-4,9,11-12H,5-6H2
InChI key:IZOOGQYKHWNGOK-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)OC2CC2)(O)O
Found 5 products.