CAS 87184-16-5
:3-fluoro-L-phenylalanyl-L-alanyl-L-alanine
Description:
3-Fluoro-L-phenylalanyl-L-alanyl-L-alanine, with the CAS number 87184-16-5, is a synthetic amino acid derivative that incorporates a fluorine atom into the phenylalanine side chain. This modification can influence the compound's biochemical properties, such as its hydrophobicity and potential interactions with biological targets. The presence of the fluorine atom may enhance the stability of the molecule and alter its pharmacokinetic properties, making it of interest in medicinal chemistry and drug design. The compound consists of three amino acid residues: phenylalanine, alanine, and another alanine, which contribute to its overall structure and functionality. As a peptide, it may exhibit specific conformational characteristics that affect its biological activity, including potential roles in protein synthesis or as a building block for larger peptides. The study of such fluorinated amino acids is significant in understanding their effects on protein structure and function, as well as their potential therapeutic applications.
Formula:C15H20FN3O4
InChI:InChI=1/C15H20FN3O4/c1-8(13(20)19-9(2)15(22)23)18-14(21)12(17)7-10-4-3-5-11(16)6-10/h3-6,8-9,12H,7,17H2,1-2H3,(H,18,21)(H,19,20)(H,22,23)/t8-,9-,12-/m0/s1
SMILES:C[C@@H](C(=N[C@@H](C)C(=O)O)O)N=C([C@H](Cc1cccc(c1)F)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.