CAS 871893-47-9
:1-[3-(phenoxymethyl)phenyl]methanamine
Description:
1-[3-(Phenoxymethyl)phenyl]methanamine, identified by its CAS number 871893-47-9, is an organic compound characterized by its amine functional group and a phenyl ring substituted with a phenoxymethyl group. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the phenoxymethyl group may influence its reactivity and interactions, potentially allowing for hydrogen bonding and π-π stacking interactions due to the aromatic nature of the structure. As an amine, it may also participate in nucleophilic reactions and can act as a base. The compound's specific applications and biological activity would depend on its structural features, which may include roles in medicinal chemistry or as intermediates in organic synthesis. Safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity. Further studies would be necessary to elucidate its full chemical behavior and potential applications in various fields.
Formula:C14H15NO
InChI:InChI=1/C14H15NO/c15-10-12-5-4-6-13(9-12)11-16-14-7-2-1-3-8-14/h1-9H,10-11,15H2
SMILES:c1ccc(cc1)OCc1cccc(c1)CN
Synonyms:- 3-(Phenoxymethyl)Benzylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
