CAS 871909-82-9

2-Chloro-N-[[[2-(2-thienyl)ethyl]amino]carbonyl]acetamide

Description:

2-Chloro-N-[[[2-(2-thienyl)ethyl]amino]carbonyl]acetamide, identified by its CAS number 871909-82-9, is a synthetic organic compound characterized by its unique structural features. It contains a chloro substituent, which contributes to its reactivity, and an acetamide functional group that is known for its ability to form hydrogen bonds, enhancing its solubility in polar solvents. The presence of a thienyl group, derived from thiophene, introduces aromatic characteristics and potential biological activity, making it of interest in medicinal chemistry. This compound may exhibit specific pharmacological properties due to its amine and carbonyl functionalities, which can interact with biological targets. Its molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or anti-inflammatory agents. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₉H₁₁ClN₂O₂S

InChI: InChI=1S/C9H11ClN2O2S/c10-6-8(13)12-9(14)11-4-3-7-2-1-5-15-7/h1-2,5H,3-4,6H2,(H2,11,12,13,14)

InChI key: InChIKey=MIVYNGIMCBDYLN-UHFFFAOYSA-N

SMILES: C(CNC(NC(CCl)=O)=O)C1=CC=CS1

Synonyms:

• Acetamide, 2-chloro-N-[[[2-(2-thienyl)ethyl]amino]carbonyl]-
• 2-Chloro-N-[[[2-(2-thienyl)ethyl]amino]carbonyl]acetamide