CymitQuimica logo

CAS 872-21-9

:

1,7,13-Tetradecatriyne

Description:
1,7,13-Tetradecatriyne is a linear alkyne characterized by the presence of three triple bonds within a 14-carbon chain. Its molecular formula is C14H22, indicating that it is a highly unsaturated hydrocarbon. The structure features a series of carbon atoms connected by alternating single and triple bonds, which contributes to its unique chemical properties. This compound is typically a colorless liquid at room temperature and is known for its high reactivity due to the presence of multiple triple bonds, making it a useful intermediate in organic synthesis. 1,7,13-Tetradecatriyne is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. It can participate in various chemical reactions, including polymerization and addition reactions, due to the reactivity of the alkyne functional groups. Additionally, it may exhibit interesting physical properties such as high boiling and melting points compared to saturated hydrocarbons of similar molecular weight. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C14H18
InChI:InChI=1S/C14H18/c1-3-5-7-9-11-13-14-12-10-8-6-4-2/h1-2H,5-12H2
InChI key:InChIKey=ZJHGXKCKUOFPDS-UHFFFAOYSA-N
SMILES:C(#CCCCCC#C)CCCCC#C
Synonyms:
  • 1,7,13-Tetradecatriyne
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.