CAS 872-56-0
:propan-2-ylcyclobutane
Description:
Propan-2-ylcyclobutane, also known as isopropylcyclobutane, is an organic compound characterized by its cyclobutane ring structure with an isopropyl group attached. It has a molecular formula of C₇H₁₂ and features a unique combination of cyclic and branched aliphatic characteristics. This compound is typically a colorless liquid at room temperature and exhibits a relatively low boiling point compared to larger hydrocarbons. Its structure contributes to its moderate polarity, making it soluble in organic solvents but less so in water. Propan-2-ylcyclobutane is of interest in various fields, including organic synthesis and materials science, due to its potential as a building block for more complex molecules. Additionally, it may exhibit interesting reactivity patterns typical of cycloalkanes, such as ring strain and potential for substitution reactions. Safety data indicates that, like many hydrocarbons, it should be handled with care to avoid inhalation or skin contact, as it may pose health risks.
Formula:C7H14
InChI:InChI=1/C7H14/c1-6(2)7-4-3-5-7/h6-7H,3-5H2,1-2H3
SMILES:CC(C)C1CCC1
Synonyms:- Cyclobutane, (1-Methylethyl)-
- Cyclobutane, isopropyl-
- Isopropylcyclobutane
- ISO-PROPYLCYCLOBUTANE
- (1-methylethyl)cyclobutane
- propan-2-ylcyclobutane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
