CAS 872-71-9
:Sodium pyrrolidinedithiocarbamate
Description:
Sodium pyrrolidinedithiocarbamate (CAS 872-71-9) is a chemical compound that belongs to the class of dithiocarbamates, which are characterized by the presence of a dithiocarbamate group (-N=C(S)S-). This compound typically appears as a white to light yellow solid and is soluble in water, making it useful in various applications. It is known for its ability to chelate metal ions, which allows it to be employed in analytical chemistry for metal ion extraction and separation. Additionally, sodium pyrrolidinedithiocarbamate exhibits antioxidant properties and has been studied for its potential biological activities, including its role in protecting cells from oxidative stress. In industrial contexts, it can be used as a reagent in the synthesis of other chemical compounds and in the formulation of pesticides and fungicides. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during use.
Formula:C5H9NS2·Na
InChI:InChI=1S/C5H9NS2.Na/c7-5(8)6-3-1-2-4-6;/h1-4H2,(H,7,8);
InChI key:InChIKey=HEERHKWUFYQKJG-UHFFFAOYSA-N
SMILES:C(=S)(S)N1CCCC1.[Na]
Synonyms:- 1-Pyrrolidinecarbodithioic acid, sodium salt
- Sodium tetramethylenedithiocarbamate
- 1-Pyrrolidinecarbodithioic acid, sodium salt (1:1)
- Sodium pyrrolidine-N-carbodithioate
- Sodium 1-pyrrolidinedithiocarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Sodium pyrrolidin-1-ylcarbamodithioate
CAS:Formula:C5H9N2NaS2Purity:80%Color and Shape:SolidMolecular weight:184.2581Sodium Pyrrolidinedithiocarbamate
CAS:Sodium PyrrolidinedithiocarbamateFormula:C5H9N2NaS2Purity:80%Color and Shape: white to off-white solidMolecular weight:184.25g/molSodium pyrrolidinedithiocarbamate
CAS:Sodium pyrrolidinedithiocarbamate is a fluorescence-based chemical probe that is used to detect the presence of low levels of biological compounds. It has been shown to be effective against a number of infectious diseases, such as tuberculosis. In addition, this compound can be used for on-line sample preparation and has been shown to have biological properties, including anti-inflammatory effects. Sodium pyrrolidinedithiocarbamate can cleave fatty acids and hydrogen bonds, making it an antimicrobial agent.
Formula:C5H8NNaS2Purity:80%MinMolecular weight:169.24 g/mol


