CAS 872041-85-5
:5-Chloropyridine-3-boronic acid
Description:
5-Chloropyridine-3-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated pyridine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. It is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are pivotal for forming carbon-carbon bonds. The presence of the chlorine atom at the 5-position of the pyridine ring can influence its reactivity and selectivity in various chemical transformations. Additionally, the boronic acid functionality allows for the formation of stable complexes with diols, making it useful in the development of sensors and in medicinal chemistry for drug design. Safety considerations should be taken into account, as boronic acids can be reactive and may pose hazards if not handled properly. Overall, 5-Chloropyridine-3-boronic acid is a valuable compound in synthetic organic chemistry and materials science.
Formula:C5H5BClNO2
InChI:InChI=1/C5H5BClNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3,9-10H
SMILES:c1c(cncc1Cl)B(O)O
Synonyms:- 5-Chloro-3-Pyridineboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Chloropyridine-3-boronic acid
CAS:Formula:C5H5BClNO2Purity:95%Color and Shape:SolidMolecular weight:157.36275-Chloropyridine-3-boronic acid
CAS:5-Chloropyridine-3-boronic acidFormula:C5H5BClNO2Purity:≥95%Color and Shape: white powderMolecular weight:157.36g/mol(5-Chloropyridin-3-yl)boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BClNO2Color and Shape:White to Light yellow powder to crystalMolecular weight:157.36(5-Chloropyridin-3-yl)boronic acid
CAS:Formula:C5H5BClNO2Purity:95%Color and Shape:SolidMolecular weight:157.36(5-Chloropyridin-3-yl)boronic acid
CAS:<p>Please enquire for more information about (5-Chloropyridin-3-yl)boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C5H5BClNO2Purity:Min. 95%Molecular weight:157.36 g/mol





