CymitQuimica logo

CAS 872050-52-7

:

Boronic acid, [4-(1-pyrenyl)phenyl]-

Description:
Boronic acid, [4-(1-pyrenyl)phenyl]- (CAS 872050-52-7) is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a pyrenyl group. This compound typically exhibits properties associated with both boronic acids and polycyclic aromatic hydrocarbons. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications such as organic synthesis, drug development, and materials science. The pyrenyl group contributes to the compound's photophysical properties, including strong fluorescence, which can be exploited in sensing and imaging applications. Additionally, the compound may exhibit unique electronic and structural characteristics due to the conjugation between the aromatic systems. Overall, [4-(1-pyrenyl)phenyl]boronic acid is a versatile compound with potential applications in organic electronics, sensor technology, and as a building block in supramolecular chemistry.
Formula:C22H15BO2
InChI:InChI=1S/C22H15BO2/c24-23(25)18-10-6-14(7-11-18)19-12-8-17-5-4-15-2-1-3-16-9-13-20(19)22(17)21(15)16/h1-13,24-25H
InChI key:ISMRPUXCQLIMJL-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)C2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2)(O)O
Found 5 products.