CymitQuimica logo

CAS 872054-57-4

:

Boron, (6-methyl-2-pyridinyl)[[2,2′-(phenylimino-κN)bis[ethanolato-κO]](2-)]-, (T-4)-

Description:
The chemical substance known as "Boron, (6-methyl-2-pyridinyl)[[2,2′-(phenylimino-κN)bis[ethanolato-κO]](2-)]-, (T-4)-" with CAS number 872054-57-4 is a boron complex featuring a pyridine derivative and an ethanolato ligand. This compound exhibits characteristics typical of organoboron compounds, including potential applications in medicinal chemistry and materials science due to its unique structural features. The presence of the pyridine ring suggests possible interactions with biological systems, while the ethanolato groups may enhance solubility and stability. The phenylimino moiety indicates potential for coordination chemistry, allowing for various bonding interactions. Such compounds are often studied for their catalytic properties, as well as their roles in organic synthesis and as ligands in coordination complexes. Overall, this substance represents a complex interplay of organic and inorganic chemistry, making it a subject of interest for further research in various chemical applications.
Formula:C16H19BN2O2
InChI:InChI=1S/C16H19BN2O2/c1-14-6-5-9-16(18-14)17-19(10-12-20-17,11-13-21-17)15-7-3-2-4-8-15/h2-9H,10-13H2,1H3
InChI key:InChIKey=GBHIVTABEQCEPX-UHFFFAOYSA-N
SMILES:CC1=N[C-]([B+3]23[N](CC[O-]2)(CC[O-]3)C4=CC=CC=C4)=CC=C1
Synonyms:
  • 6-Methylpyridine-2-boronic acid N-phenyldiethanolamine ester
  • Boron, (6-methyl-2-pyridinyl)[[2,2′-(phenylimino-κN)bis[ethanolato-κO]](2-)]-, (T-4)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.