CAS 87206-33-5: (1aR,4R,4aS,7R,7aS,9aR)-4,7,9a-trimethyldecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one

Description: The chemical substance with the name "(1aR,4R,4aS,7R,7aS,9aR)-4,7,9a-trimethyldecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one" and CAS number "87206-33-5" is a complex organic compound characterized by its unique bicyclic structure, which incorporates both furan and naphthalene moieties. This compound features multiple stereocenters, contributing to its chiral nature and potentially influencing its biological activity and interactions. The presence of the oxirane (epoxide) functional group suggests it may exhibit reactivity typical of epoxides, such as undergoing ring-opening reactions under certain conditions. Additionally, the trimethyl groups indicate a degree of steric hindrance, which can affect the compound's physical properties, such as boiling point and solubility. Its structural complexity may also suggest potential applications in fields such as pharmaceuticals, agrochemicals, or as a synthetic intermediate. However, specific information regarding its reactivity, stability, and biological properties would require further investigation through experimental studies.

Formula: C₁₅H₂₂O₃

InChI: InChI=1/C15H22O3/c1-8-4-5-11-9(2)12(16)17-15(11)10(8)6-7-14(3)13(15)18-14/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15?/m1/s1

Dihydroarteannuin B

CAS: 87206-33-5

• Purity: ≥98%
• Molecular weight: 250.33g/mol

(3R)-dihydroarteannuin B

CAS: 87206-33-5

• Formula: C₁₅H₂₂O₃
• Purity: 95%~99%
• Molecular weight: 250.338

Dihydroarteannuin B

CAS: 87206-33-5

Dihydroarteannuin B ((3R)-dihydroarteannuin B) is a natural Dihydroarteannuin.

• Formula: C₁₅H₂₂O₃
• Purity: 98.18%
• Color and Shape: Solid
• Molecular weight: 250.33