CAS 87206-45-9

1,2,4,5-Tetradeoxy-1,5-epithio-2-(methoxycarbonyl)pentitol

Description:

1,2,4,5-Tetradeoxy-1,5-epithio-2-(methoxycarbonyl)pentitol is a specialized chemical compound characterized by its unique structural features. It belongs to the class of pentitols, which are sugar alcohols derived from pentoses. The presence of the epithio group indicates that it contains a sulfur atom, contributing to its reactivity and potential applications in organic synthesis. The methoxycarbonyl group suggests that the compound can undergo further chemical transformations, making it useful in various synthetic pathways. Its tetradeoxy nature implies that it lacks four hydroxyl groups typically found in sugar alcohols, which can influence its solubility and biological activity. The compound's specific stereochemistry and functional groups may also affect its interactions with biological systems, making it of interest in medicinal chemistry and biochemistry. Overall, 1,2,4,5-Tetradeoxy-1,5-epithio-2-(methoxycarbonyl)pentitol is a complex molecule with potential applications in research and industry, particularly in the development of new pharmaceuticals or biochemical tools.

Formula: C₇H₁₂O₃S

InChI: InChI=1S/C7H12O3S/c1-10-7(9)5-4-11-3-2-6(5)8/h5-6,8H,2-4H2,1H3

InChI key: InChIKey=WCYCFRFETLXIJS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C(O)CCSC1

Synonyms:

• Pentitol, 1,2,4,5-tetradeoxy-1,5-epithio-2-(methoxycarbonyl)-
• 1,2,4,5-Tetradeoxy-1,5-epithio-2-(methoxycarbonyl)pentitol
• 2H-Thiopyran-3-carboxylic acid, tetrahydro-4-hydroxy-, methyl ester