CAS 872088-03-4
:1-(6-chloropyridin-3-yl)propan-1-one
Description:
1-(6-Chloropyridin-3-yl)propan-1-one, with the CAS number 872088-03-4, is an organic compound characterized by its structure, which includes a propanone moiety attached to a chlorinated pyridine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the chloropyridine group imparts specific reactivity, making it useful in various chemical syntheses, particularly in medicinal chemistry and agrochemical applications. The compound may exhibit biological activity due to the pyridine ring, which is known for its role in various pharmacological properties. Additionally, it may participate in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine atom. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, 1-(6-chloropyridin-3-yl)propan-1-one is a valuable compound in synthetic organic chemistry with potential applications in drug development.
Formula:C8H8ClNO
InChI:InChI=1/C8H8ClNO/c1-2-7(11)6-3-4-8(9)10-5-6/h3-5H,2H2,1H3
SMILES:CCC(=O)c1ccc(Cl)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
