CAS 872108-06-0

3-[4-(Imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-2-propenoic acid

Description:

3-[4-(Imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-2-propenoic acid, with the CAS number 872108-06-0, is a chemical compound characterized by its unique structural features, which include an imidazo[1,2-a]pyridine moiety and a propenoic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the imidazo[1,2-a]pyridine structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The propenoic acid part of the molecule may impart acidity and reactivity, allowing for various chemical transformations. Additionally, the methoxy group enhances solubility and may influence the compound's pharmacokinetic properties. Overall, this compound's characteristics suggest potential applications in drug development, particularly in areas targeting specific biological pathways or diseases. However, detailed studies on its biological activity, stability, and synthesis would be necessary to fully understand its potential uses and implications in research and medicine.

Formula: C₁₇H₁₄N₂O₃

InChI: InChI=1S/C17H14N2O3/c20-17(21)9-6-13-4-7-15(8-5-13)22-12-14-11-19-10-2-1-3-16(19)18-14/h1-11H,12H2,(H,20,21)

InChI key: InChIKey=UGISWITUTBOCEB-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C=CC(O)=O)C=C1)C=2N=C3N(C2)C=CC=C3

Synonyms:

• 3-[4-(Imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-2-propenoic acid
• 2-Propenoic acid, 3-[4-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-

(2E)-3-[4-({Imidazo[1,2-a]pyridin-2-yl}methoxy)phenyl]prop-2-enoic acid

CAS: 872108-06-0

Versatile small molecule scaffold

Formula: C₁₇H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 294.3 g/mol

Ref: 3D-XJB10806