CAS 87213-50-1
:8-bromo-6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
Description:
8-Bromo-6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine is a synthetic compound that belongs to the class of benzodiazepines, which are known for their psychoactive properties. This particular compound features a triazole ring fused to a benzodiazepine structure, contributing to its unique pharmacological profile. The presence of bromine and chlorine substituents enhances its lipophilicity and may influence its biological activity, potentially affecting receptor binding and metabolic pathways. The compound is characterized by its complex molecular structure, which includes multiple aromatic rings and heteroatoms, making it a subject of interest in medicinal chemistry for its potential therapeutic applications. Its CAS number, 87213-50-1, allows for easy identification in chemical databases. As with many benzodiazepines, it may exhibit anxiolytic, sedative, or anticonvulsant effects, but specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C17H12BrClN4
InChI:InChI=1/C17H12BrClN4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3
SMILES:Cc1nnc2CN=C(c3ccccc3Cl)c3cc(ccc3n12)Br
Synonyms:- 4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine, 8-bromo-6-(2-chlorophenyl)-1-methyl-
- Clobromazolam
- Phenazolam
- 8-bromo-6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Clobromazolam
CAS:Controlled ProductClobromazolam is an inhibitor of apoptosis in human and Chinese hamster ovary cells. It acts by inhibiting the activity of a protein kinase that is involved in the regulation of cell growth and division. Clobromazolam has been shown to be effective against various types of cancer, including lung, breast, prostate, and colon cancer. It has also been found to be effective against tumors that are resistant to other anticancer drugs, such as nintedanib. Clobromazolam is a urine analog of other protein kinase inhibitors and can be used as a tool for studying the role of kinases in cancer cell growth and proliferation.
Formula:C17H12BrClN4Purity:Min. 95%Molecular weight:387.7 g/molPhenazolam
CAS:Phenazolam is an analytical reference standard categorized as a benzodiazepine. [1] This product is intended for research and forensic applications.Formula:C17H12BrClN4Color and Shape:SolidMolecular weight:387.66


