CAS 872131-45-8
:(2E)-1-[5-(benzyloxy)-2-hydroxyphenyl]-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-[5-(benzyloxy)-2-hydroxyphenyl]-3-phenylprop-2-en-1-one, with the CAS number 872131-45-8, is a synthetic organic compound characterized by its complex structure that includes a phenylpropene backbone. This compound features a conjugated system, which contributes to its potential as a chromophore, making it interesting for applications in organic electronics and photochemistry. The presence of a benzyloxy group and a hydroxyl group on the aromatic ring enhances its solubility and may influence its reactivity and biological activity. The compound is likely to exhibit properties such as antioxidant activity, given the presence of the hydroxyl group, which can donate hydrogen atoms. Additionally, its structural features suggest potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, this compound's unique characteristics stem from its functional groups and conjugated system, which may impart various chemical and biological properties.
Formula:C22H18O3
InChI:InChI=1/C22H18O3/c23-21(13-11-17-7-3-1-4-8-17)20-15-19(12-14-22(20)24)25-16-18-9-5-2-6-10-18/h1-15,24H,16H2/b13-11+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Oxo-1-phenyl-3-(2’-hydroxy-5-benzyloxyphenyl)propene
CAS:Controlled Product<p>Applications 3-Oxo-1-phenyl-3-(2’-hydroxy-5-benzyloxyphenyl)propene (cas# 872131-45-8) is a compound useful in organic synthesis.<br></p>Formula:C22H18O3Color and Shape:NeatMolecular weight:330.38
