CAS 87219-80-5
:(3,3-diethoxyprop-1-yn-1-yl)(trimethyl)silane
Description:
(3,3-Diethoxyprop-1-yn-1-yl)(trimethyl)silane, with the CAS number 87219-80-5, is an organosilicon compound characterized by the presence of both a silane group and an alkyne functional group. This compound features a propynyl moiety substituted with two ethoxy groups at the 3-position, which contributes to its unique reactivity and solubility properties. The trimethylsilyl group enhances its stability and volatility, making it useful in various synthetic applications. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic silane and hydrophilic ethoxy groups, allowing for potential applications in organic synthesis and materials science. Additionally, the presence of the alkyne functionality suggests that it may participate in reactions such as cross-coupling or cycloaddition, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling, as organosilicon compounds can vary in toxicity and reactivity.
Formula:C10H20O2Si
InChI:InChI=1/C10H20O2Si/c1-6-11-10(12-7-2)8-9-13(3,4)5/h10H,6-7H2,1-5H3
SMILES:CCOC(C#C[Si](C)(C)C)OCC
Synonyms:- Silane, (3,3-diethoxy-1-propyn-1-yl)trimethyl-
- (3,3-Diethoxyprop-1-yn-1-yl)(trimethyl)silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(Trimethylsilyl)propiolaldehyde diethyl acetal, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H20O2SiPurity:97%Molecular weight:200.353-Trimethylsilylpropargyl aldehyde diethyl acetal
CAS:S20128 - 3-Trimethylsilylpropargyl aldehyde diethyl acetal
Formula:C10H20O2SiPurity:98%Color and Shape:LiquidMolecular weight:200.353

