CAS 872196-57-1

3-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid

Description:

3-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid, with the CAS number 872196-57-1, is a chemical compound characterized by its unique structure that combines a benzoic acid moiety with a piperidine-derived side chain. This compound features a piperidine ring that is substituted with a carbonyl group, contributing to its potential reactivity and biological activity. The presence of the ethoxy group enhances its solubility in organic solvents, which can be advantageous for various applications in medicinal chemistry and drug development. The carboxylic acid functional group in the benzoic acid portion provides acidic properties, allowing for potential interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in research related to therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would typically be determined through experimental studies and may vary based on environmental conditions.

Formula: C₁₄H₁₇NO₄

InChI: InChI=1/C14H17NO4/c16-13(15-7-2-1-3-8-15)10-19-12-6-4-5-11(9-12)14(17)18/h4-6,9H,1-3,7-8,10H2,(H,17,18)

SMILES: C1CCN(CC1)C(=O)COc1cccc(c1)C(=O)O

3-(2-Oxo-2-piperidin-1-yl-ethoxy)-benzoic acid

CAS: 872196-57-1

Formula: C₁₄H₁₇NO₄

Purity: 95.0%

Molecular weight: 263.293

Ref: 10-F057887