CAS 87226-41-3
:(-)-Etodolac
Description:
(-)-Etodolac is a nonsteroidal anti-inflammatory drug (NSAID) primarily used for its analgesic and anti-inflammatory properties. It is classified as a chiral compound, with the (-) enantiomer being the active form that exhibits therapeutic effects. The substance functions by inhibiting cyclooxygenase (COX) enzymes, which play a crucial role in the synthesis of prostaglandins, mediators of inflammation and pain. (-)-Etodolac is typically administered orally and is known for its relatively favorable gastrointestinal safety profile compared to other NSAIDs. Its chemical structure includes a carboxylic acid group, which contributes to its acidity and solubility characteristics. The drug is often prescribed for conditions such as osteoarthritis, rheumatoid arthritis, and acute pain. Additionally, (-)-Etodolac has been studied for its potential effects on various inflammatory conditions beyond pain relief. As with all medications, it is essential to consider potential side effects and contraindications, and it should be used under the guidance of a healthcare professional.
Formula:C17H21NO3
InChI:InChI=1S/C17H21NO3/c1-3-11-6-5-7-12-13-8-9-21-17(4-2,10-14(19)20)16(13)18-15(11)12/h5-7,18H,3-4,8-10H2,1-2H3,(H,19,20)/t17-/m1/s1
InChI key:InChIKey=NNYBQONXHNTVIJ-QGZVFWFLSA-N
SMILES:C(C(O)=O)[C@]1(CC)C2=C(C=3C(N2)=C(CC)C=CC3)CCO1
Synonyms:- (1R)-1,8-Diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole-1-acetic acid
- (-)-Etodolic acid
- R-Etodolac
- Pyrano[3,4-b]indole-1-acetic acid, 1,8-diethyl-1,3,4,9-tetrahydro-, (1R)-
- Pyrano[3,4-b]indole-1-acetic acid, 1,8-diethyl-1,3,4,9-tetrahydro-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(R)-(-)-Etodolac
CAS:Controlled Product<p>Applications The R-enantiomer of Etodolac (E933090). Anti-inflammatory; analgesic.<br>References Boxenbaum, H., et al.: J. Pharmacokin. Biopharm., 10, 201 (1982), Iwatsubo, T., et al.: Biopharm. Drug Dispos., 17, 273 (1996), Obach, R., et al.: J. Pharmacol. Exp. Ther., 283, 46 (1997),<br></p>Formula:C17H21NO3Color and Shape:NeatMolecular weight:287.354


