CAS 87234-30-8

1-(2-Propen-1-yl)cyclopropanol

Description:

1-(2-Propen-1-yl)cyclopropanol, also known by its CAS number 87234-30-8, is an organic compound characterized by a cyclopropane ring substituted with a propenyl group and a hydroxyl group. This compound features a three-membered cyclopropane structure, which contributes to its unique reactivity and strain. The presence of the propenyl group introduces unsaturation, making it a potential candidate for various chemical reactions, including polymerization and addition reactions. The hydroxyl group (–OH) imparts alcohol characteristics, influencing its solubility in polar solvents and its ability to participate in hydrogen bonding. This compound may exhibit interesting biological activities and can be utilized in synthetic organic chemistry for the development of more complex molecules. Its structural features suggest potential applications in the fragrance industry or as a precursor in the synthesis of pharmaceuticals. However, specific reactivity and stability can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.

Formula: C₆H₁₀O

InChI: InChI=1S/C6H10O/c1-2-3-6(7)4-5-6/h2,7H,1,3-5H2

InChI key: InChIKey=RHWAZBHLVGJNTH-UHFFFAOYSA-N

SMILES: C(C=C)C1(O)CC1

Synonyms:

• Cyclopropanol, 1-(2-propen-1-yl)-
• 1-(2-Propen-1-yl)cyclopropanol
• Cyclopropanol, 1-(2-propenyl)-