CAS 87234-77-3
:2,3-Dihydro-5-methoxy-3,3-dimethyl-1H-indole
Description:
2,3-Dihydro-5-methoxy-3,3-dimethyl-1H-indole, with the CAS number 87234-77-3, is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features a methoxy group (-OCH3) and two methyl groups (-CH3) attached to the indole framework, which contribute to its unique chemical properties. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents, while the dimethyl substitutions can influence its reactivity and stability. 2,3-Dihydro-5-methoxy-3,3-dimethyl-1H-indole may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor or intermediate in the development of various pharmaceuticals or agrochemicals. As with many indole derivatives, it may also display interesting optical and electronic properties, which can be explored for applications in materials science.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-11(2)7-12-10-5-4-8(13-3)6-9(10)11/h4-6,12H,7H2,1-3H3
InChI key:InChIKey=JYWXNYIUDFMBCL-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(NC1)=CC=C(OC)C2
Synonyms:- 2,3-Dihydro-5-methoxy-3,3-dimethyl-1H-indole
- 3,3-Dimethyl-5-methoxy-indoline
- 5-Methoxy-3,3-dimethylindoline
- 1H-Indole, 2,3-dihydro-5-methoxy-3,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
