CAS 87235-61-8
:N-(2-aminoethyl)-4-chlorobenzamide
Description:
N-(2-aminoethyl)-4-chlorobenzamide, with the CAS number 87235-61-8, is an organic compound characterized by its amide functional group and a chlorinated aromatic ring. This substance features a 4-chlorobenzamide structure, where a chlorine atom is substituted at the para position of the benzene ring, and an aminoethyl group is attached to the nitrogen of the amide. The presence of the amino group contributes to its potential as a ligand in coordination chemistry and biological applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its amine and amide functionalities. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its purity and the specific conditions under which it is handled. N-(2-aminoethyl)-4-chlorobenzamide may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules or as a building block in organic synthesis.
Formula:C9H11ClN2O
InChI:InChI=1/C9H11ClN2O/c10-8-3-1-7(2-4-8)9(13)12-6-5-11/h1-4H,5-6,11H2,(H,12,13)
SMILES:c1cc(ccc1C(=O)NCCN)Cl
Synonyms:- benzamide, N-(2-aminoethyl)-4-chloro-
- N-(2-Aminoethyl)-P-Chlorobenzamide
- [Synonyms]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ro 16-6491
CAS:Ro 16-6491 is a selective, reversible, orally-active inhibitor of MAO-B.Formula:C9H11ClN2OColor and Shape:SolidMolecular weight:198.65
