CymitQuimica logo

CAS 872355-55-0

:

6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid

Description:
6-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 6-position and a carboxylic acid functional group at the 5-position, influencing its reactivity and solubility. It is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and drug development, particularly for its potential biological activities, which may include effects on neurotransmitter systems. Its structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Additionally, the presence of nitrogen atoms in the ring structure can impart basicity, affecting its interaction with other chemical species. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-5-7(9(12)13)4-6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11)(H,12,13)
InChI key:LWQIPNHJSKATMP-UHFFFAOYSA-N
SMILES:Cc1c(cc2ccnc2[nH]1)C(=O)O
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methyl-
  • 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
  • 6-Methyl-7-azaindole-5-carboxylic acid
Found 4 products.