CAS 872355-70-9

6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid

Description:

6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The carboxylic acid group can participate in various chemical reactions, such as esterification and amidation, while the chlorine atom can serve as a site for further substitution reactions. Its molecular structure allows for potential interactions with biological targets, which is valuable in the design of pharmaceuticals. As with many heterocycles, it may also display interesting electronic properties, influencing its reactivity and stability. Overall, 6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid is a compound of significant interest in both synthetic and medicinal chemistry.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-4-3-6-5(1-2-10-6)11-7(4)8(12)13/h1-3,10H,(H,12,13)

InChI key: InChIKey=UMARDXZOKXJHEB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C2C(=CC1Cl)NC=C2

Synonyms:

• 6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid
• 1H-Pyrrolo[3,2-b]pyridine-5-carboxylic acid, 6-chloro-

6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid

CAS: 872355-70-9

6-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid

Purity: 95%

Molecular weight: 196.59g/mol

Ref: 54-OR1053004