CAS 87237-39-6
:H-D-Tyr-Val-NH2
Description:
H-D-Tyr-Val-NH2, also known as a peptide, is a dipeptide composed of the amino acids tyrosine (Tyr) and valine (Val), with an amine group (-NH2) at one end. This compound is characterized by its specific sequence of amino acids, which influences its biological activity and properties. The presence of the aromatic side chain from tyrosine contributes to its hydrophobic characteristics, while the valine residue adds to its structural stability. Peptides like H-D-Tyr-Val-NH2 are often studied for their roles in biological processes, including signaling and enzyme activity. They can exhibit various properties such as solubility in water or organic solvents, depending on their amino acid composition and sequence. Additionally, this compound may have applications in pharmaceuticals, particularly in drug design and development, due to its potential interactions with biological targets. Understanding its characteristics, including stability, reactivity, and biological activity, is crucial for its application in research and medicine.
Formula:C14H21N3O3
InChI:InChI=1/C14H21N3O3/c1-8(2)12(13(16)19)17-14(20)11(15)7-9-3-5-10(18)6-4-9/h3-6,8,11-12,18H,7,15H2,1-2H3,(H2,16,19)(H,17,20)/t11-,12-/m0/s1
SMILES:CC(C)[C@@H](C(=N)O)N=C([C@H](Cc1ccc(cc1)O)N)O
Synonyms:- Tyrosylvalinamide
- Tyr-val-NH2
- L-tyrosyl-L-valinamide
- D-Tyr-Val
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
H-D-Tyr-Val-NH2
CAS:H-D-Tyr-Val-NH2 is a regulatory group that acts as the prosthetic group for a number of peptidyl and peptide hormones. H-D-Tyr-Val-NH2 is also involved in catalytic mechanism, as it is the amino acid responsible for the formation of peptide bonds in proteins. H-D-Tyr-Val-NH2 is found in high concentrations in the cerebriform tissue and has been shown to be important for the biosynthesis of amides, which are prohormones. H-D-Tyr-Val NH2 also participates in a number of cellular reactions, including those that have a kinetic rate.Formula:C14H21N3O3Molecular weight:279.33 g/mol
