CAS 87239-96-1
:4-Amino-5-(3-bromophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-Amino-5-(3-bromophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a heterocyclic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features an amino group (-NH2) and a thione group (C=S), contributing to its reactivity and potential biological activity. The presence of the 3-bromophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The compound is typically synthesized through methods involving the reaction of appropriate precursors, often under acidic or basic conditions. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Additionally, its structural features suggest potential applications in agrochemicals or as a building block in organic synthesis. As with many nitrogen-containing heterocycles, it may also display interesting coordination chemistry with metal ions. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C8H7BrN4S
InChI:InChI=1/C8H7BrN4S/c9-6-3-1-2-5(4-6)7-11-12-8(14)13(7)10/h1-4H,10H2,(H,12,14)
InChI key:InChIKey=GVXBYQYIFQIOCT-UHFFFAOYSA-N
SMILES:NN1C(C2=CC(Br)=CC=C2)=NNC1=S
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-amino-5-(3-bromophenyl)-2,4-dihydro-
- 4H-1,2,4-triazole-3-thiol, 4-amino-5-(3-bromophenyl)-
- 4-Amino-5-(3-bromophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
- 4-Amino-5-(3-bromophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
- 4-amino-5-(3-bromophenyl)-2H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.