CAS 87240-06-0
:7-bromo-5-nitro-2,3-dihydro-1H-indole
Description:
7-Bromo-5-nitro-2,3-dihydro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 7-position and a nitro group at the 5-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group and the electron-donating characteristics of the indole moiety. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it of interest in synthetic organic chemistry. Additionally, compounds like this one can have biological significance, potentially serving as intermediates in the synthesis of pharmaceuticals or as probes in biochemical research. Safety data should be consulted, as halogenated and nitro compounds can pose health and environmental risks.
Formula:C8H7BrN2O2
InChI:InChI=1/C8H7BrN2O2/c9-7-4-6(11(12)13)3-5-1-2-10-8(5)7/h3-4,10H,1-2H2
SMILES:C1CNc2c1cc(cc2Br)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Bromo-5-nitroindoline
CAS:Formula:C8H7BrN2O2Purity:98%Color and Shape:SolidMolecular weight:243.05747-Bromo-5-nitroindoline
CAS:<p>7-Bromo-5-nitroindoline is a synthetic compound that has been shown to bind to auxin, which is a plant hormone. It has been used in photoaffinity labeling and can be used in the synthesis of other compounds. 7-Bromo-5-nitroindoline binds reversibly and covalently to auxin in the presence of light. The regiospecificity of this binding allows for the determination of specific properties of auxin binding. 7-Bromo-5-nitroindoline is also used as a tritiated label in syntheses and as a deuterated label for photoaffinity labeling.</p>Formula:C8H7BrN2O2Purity:Min. 95%Molecular weight:243.06 g/mol
