CAS 87240-31-1
:dimethyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Description:
Dimethyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is a complex organic compound characterized by its dihydropyridine core, which is a five-membered ring containing nitrogen. This compound features multiple functional groups, including ester groups from the dimethyl dicarboxylate moiety and a difluoromethylthio substituent, which can influence its reactivity and biological activity. The presence of the difluoromethyl group may enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. The dimethyl groups contribute to steric hindrance, which can impact the compound's conformation and stability. This substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural complexity suggests potential applications in drug development, particularly in areas targeting cardiovascular or neurological conditions, where dihydropyridine derivatives are often explored. As with many organic compounds, its solubility, stability, and reactivity will depend on environmental conditions such as pH and temperature.
Formula:C18H19F2NO4S
InChI:InChI=1/C18H19F2NO4S/c1-9-13(16(22)24-3)15(14(10(2)21-9)17(23)25-4)11-7-5-6-8-12(11)26-18(19)20/h5-8,15,18,21H,1-4H3
SMILES:CC1=C(C(c2ccccc2SC(F)F)C(=C(C)N1)C(=O)OC)C(=O)OC
Synonyms:- 2,6-Dimethyl-3,5-dicarbomethoxy-4-(o-difluoromethylthiophenyl)-1,4-dihydropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.