CAS 872407-86-8

1-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)ethanone

Description:

1-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)ethanone, with the CAS number 872407-86-8, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a ketone functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the dimethyl groups on the pyrazole ring enhances its lipophilicity, which may influence its biological activity and solubility properties. Typically, compounds of this nature are investigated for their pharmacological properties, including anti-inflammatory and analgesic effects. The molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, 1-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)ethanone represents a versatile scaffold in the field of organic and medicinal chemistry.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-4-7(8)5(2)10(9-4)6(3)11/h8H2,1-3H3

InChI key: InChIKey=GPJJFVKGKLFVOT-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C(C)=C(N)C(C)=N1

Synonyms:

• 1-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)ethanone
• Ethanone, 1-(4-amino-3,5-dimethyl-1H-pyrazol-1-yl)-
• 1H-Pyrazol-4-amine, 1-acetyl-3,5-dimethyl-
• 1-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)ethan-1-one