CAS 872423-54-6

B-[5-(3-Methylphenyl)-2-thiazolyl]boronic acid

Description:

B-[5-(3-Methylphenyl)-2-thiazolyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The thiazole ring in its structure contributes to its biological activity and potential as a pharmaceutical agent. The presence of the 3-methylphenyl group enhances its lipophilicity, which can influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its reactivity is primarily attributed to the boron atom, which can participate in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, boronic acids like this one are often utilized in the development of sensors and in the field of materials science. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₁₀BNO₂S

InChI: InChI=1S/C10H10BNO2S/c1-7-3-2-4-8(5-7)9-6-12-10(15-9)11(13)14/h2-6,13-14H,1H3

InChI key: InChIKey=KEBHCRSHXIDNLC-UHFFFAOYSA-N

SMILES: B(O)(O)C=1SC(=CN1)C2=CC(C)=CC=C2

Synonyms:

• Boronic acid, B-[5-(3-methylphenyl)-2-thiazolyl]-
• B-[5-(3-Methylphenyl)-2-thiazolyl]boronic acid
• Boronic acid, [5-(3-methylphenyl)-2-thiazolyl]-
• [5-(m-Tolyl)thiazol-2-yl]boronic acid
• [5-(3-Methylphenyl)-1,3-thiazol-2-yl]boronic acid

(5-Phenylthiazol-2-yl)boronic acid

CAS: 872423-54-6

Formula: C₉H₈BNO₂S

Molecular weight: 205.0413

Ref: IN-DA01DOOC