CymitQuimica logo

CAS 872473-26-2

:

2-amino-4-(2H-tetrazol-5-yl)benzoic acid

Description:
2-Amino-4-(2H-tetrazol-5-yl)benzoic acid, identified by its CAS number 872473-26-2, is a chemical compound that features both an amino group and a tetrazole ring, contributing to its unique properties. This substance is characterized by its aromatic structure, which includes a benzoic acid moiety, making it a potential candidate for various applications in pharmaceuticals and biochemistry. The presence of the tetrazole ring enhances its biological activity, often imparting properties such as increased solubility and stability. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its synthesis often involves multi-step organic reactions, and it may be utilized in research related to drug development, particularly in the design of compounds with antimicrobial or anti-inflammatory properties. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C8H7N5O2
InChI:InChI=1/C8H7N5O2/c9-6-3-4(7-10-12-13-11-7)1-2-5(6)8(14)15/h1-3H,9H2,(H,14,15)(H,10,11,12,13)
SMILES:c1cc(c(cc1c1n[nH]nn1)N)C(=O)O
Synonyms:
  • benzoic acid, 2-amino-4-(1H-tetrazol-5-yl)-
Found 2 products.