CAS 872576-92-6

6-iodo-4-oxo-1H-quinoline-3-carbonitrile

Description:

6-Iodo-4-oxo-1H-quinoline-3-carbonitrile is a chemical compound characterized by its unique quinoline structure, which consists of a fused benzene and pyridine ring. The presence of an iodine atom at the 6-position and a carbonitrile group at the 3-position contributes to its reactivity and potential biological activity. The carbonyl group at the 4-position enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties, as quinoline derivatives are often explored for their antimicrobial, antiviral, and anticancer activities. Additionally, the presence of the iodine atom can influence the compound's lipophilicity and bioavailability. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₅IN₂O

InChI: InChI=1/C10H5IN2O/c11-7-1-2-9-8(3-7)10(14)6(4-12)5-13-9/h1-3,5H,(H,13,14)

SMILES: c1cc2c(cc1I)c(=O)c(C#N)c[nH]2

Synonyms:

• 6-Iod-4-oxo-1,4-dihydrochinolin-3-carbonitril
• 6-Iodo-4-Oxo-1,4-Dihydroquinoline-3-Carbonitrile