CAS 872577-50-9

ethyl 3-cyano-4-oxo-1H-quinoline-6-carboxylate

Description:

Ethyl 3-cyano-4-oxo-1H-quinoline-6-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a cyano group (-CN) and a carboxylate ester group (-COOEt), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonyl group (C=O) at the 4-position and the cyano group at the 3-position enhances its electrophilic character, making it a useful intermediate in various chemical reactions. The ethyl ester moiety provides solubility in organic solvents, facilitating its use in diverse chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its unique structural features allow for potential modifications that could lead to derivatives with enhanced properties. As with many quinoline derivatives, it may also display fluorescence, which can be advantageous in analytical applications.

Formula: C₁₃H₁₀N₂O₃

InChI: InChI=1/C13H10N2O3/c1-2-18-13(17)8-3-4-11-10(5-8)12(16)9(6-14)7-15-11/h3-5,7H,2H2,1H3,(H,15,16)

SMILES: CCOC(=O)c1ccc2c(c1)c(=O)c(C#N)c[nH]2

Synonyms:

• Ethyl 3-Cyano-4-Oxo-1,4-Dihydroquinoline-6-Carboxylate
• Ethyl-3-cyan-4-oxo-1,4-dihydrochinolin-6-carboxylat