CAS 872607-89-1
:1-methylindazole-5-carbaldehyde
Description:
1-Methylindazole-5-carbaldehyde is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 1-position and an aldehyde functional group at the 5-position distinguishes this compound. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The aldehyde group is reactive, making it useful for various chemical reactions, including condensation and nucleophilic addition. Additionally, 1-methylindazole-5-carbaldehyde may exhibit biological activity, which can be explored for pharmaceutical development. Its molecular structure contributes to its unique properties, influencing solubility, reactivity, and interaction with biological targets. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled, ingested, or in contact with skin.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-11-9-3-2-7(6-12)4-8(9)5-10-11/h2-6H,1H3
SMILES:Cn1c2ccc(cc2cn1)C=O
Synonyms:- 1H-Indazole-5-carboxaldehyde, 1-methyl-
- 1-methyl-1H-indazole-5-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methyl-1H-indazole-5-carbaldehyde
CAS:Formula:C9H8N2OPurity:97%Color and Shape:SolidMolecular weight:160.17261-Methyl-1H-indazole-5-carboxaldehyde
CAS:1-Methyl-1H-indazole-5-carboxaldehydeFormula:C9H8N2OPurity:97%Color and Shape: yellow powderMolecular weight:160.17262g/mol1-Methyl-1H-indazole-5-carbaldehyde
CAS:1-Methyl-1H-indazole-5-carbaldehyde is a selective inhibitor of the enzyme lysine acetyltransferase (KAT). KAT inhibitors are a new class of compounds that have been shown to be effective in inhibiting the growth of acute myeloid leukaemia cells, with little effect on other cells. 1-Methyl-1H-indazole-5-carbaldehyde has potent inhibitory activity against human myeloid leukemia cells and does not affect the viability of normal human erythrocytes or peripheral blood mononuclear cells. This compound is reversible, meaning it can be turned off when it is no longer needed. 1-Methyl-1H-indazole-5-carbaldehyde has also been shown to inhibit maoA and thymidine phosphorylase in vitro.Formula:C9H8N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:160.17 g/mol1-Methyl-1H-indazole-5-carbaldehyde
CAS:Formula:C9H8N2OPurity:95%Color and Shape:SolidMolecular weight:160.176



