CymitQuimica logo

CAS 872624-52-7

:

Benzoicacid, 2-amino-5-iodo-4-(trifluoromethyl)-, methylester

Description:
Benzoic acid, 2-amino-5-iodo-4-(trifluoromethyl)-, methyl ester, identified by CAS number 872624-52-7, is an organic compound characterized by its benzoic acid structure modified with an amino group, an iodine atom, and a trifluoromethyl group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and solubility in various media. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and affecting the compound's biological activity. Additionally, the iodine substituent can contribute to the compound's reactivity in nucleophilic substitution reactions. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and material science. Its synthesis and applications would be guided by the functional groups present, allowing for potential modifications and derivatizations in various chemical contexts.
Formula:C9H7F3INO2
InChI:InChI=1S/C9H7F3INO2/c1-16-8(15)4-2-6(13)5(3-7(4)14)9(10,11)12/h2-3H,14H2,1H3
InChI key:ILCBGAMVQYUDFL-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C(C=C1N)C(F)(F)F)I
Synonyms:
  • 2-Amino-5-iodo-4-trifluoromethylbenzoicacid methyl ester
  • Methyl 2-amino-5-iodo-4-trifluoromethylbenzoate
Found 4 products.