CymitQuimica logo

CAS 872624-58-3

:

1,2,3,4-Tetrahydro-7-methyl-8-(trifluoromethyl)-5H-1-benzazepin-5-one

Description:
1,2,3,4-Tetrahydro-7-methyl-8-(trifluoromethyl)-5H-1-benzazepin-5-one is a chemical compound characterized by its complex bicyclic structure, which includes a benzene ring fused to a seven-membered azepine ring. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting biological activity. The compound features a ketone functional group, contributing to its reactivity and potential interactions in various chemical environments. Its tetrahydro configuration indicates that it is saturated, which can affect its stability and reactivity compared to unsaturated analogs. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of the methyl group suggests potential steric effects that could influence its interaction with biological targets. Overall, the unique structural features of this compound may lead to diverse applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C12H12F3NO
InChI:InChI=1S/C12H12F3NO/c1-7-5-8-10(6-9(7)12(13,14)15)16-4-2-3-11(8)17/h5-6,16H,2-4H2,1H3
InChI key:InChIKey=RQSXYGCBBWGSBC-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(C(F)(F)F)=C(C)C2)NCCC1
Synonyms:
  • 7-Methyl-8-trifluoromethyl-1,2,3,4-tetrahydrobenzo[b]azepin-5-one
  • 1,2,3,4-Tetrahydro-7-methyl-8-(trifluoromethyl)-5H-1-benzazepin-5-one
  • 5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro-7-methyl-8-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.