CymitQuimica logo

CAS 87266-37-3

:

Imidazol-1-ylacetic acid hydrochloride

Description:
Imidazol-1-ylacetic acid hydrochloride is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound is a derivative of imidazole and features an acetic acid moiety, contributing to its acidic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in various biological systems and can interact with enzymes and receptors. Imidazol-1-ylacetic acid hydrochloride may be used in research settings, particularly in studies related to biochemistry and medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound is of interest for its potential applications in drug development and as a biochemical tool.
Formula:C5H7ClN2O2
InChI:InChI=1/C5H6N2O2.ClH/c8-5(9)3-4-6-1-2-7-4;/h1-2H,3H2,(H,6,7)(H,8,9);1H
InChI key:JKZJSYXGKHQHRA-UHFFFAOYSA-N
SMILES:c1c[nH]c(CC(=O)O)n1.Cl
Synonyms:
  • 1H-Imidazole-1-acetic acid hydrochloride
  • 2-(1H-imidazol-2-yl)acetic acid hydrochloride
Found 5 products.