CAS 87269-86-1

(E)-(-)-Octahydrocyclopenta[b]pyrrole-2-carboxylic acid hydrochloride

Description:

(E)-(-)-Octahydrocyclopenta[b]pyrrole-2-carboxylic acid hydrochloride, with the CAS number 87269-86-1, is a chemical compound characterized by its bicyclic structure, which includes a cyclopentane ring fused to a pyrrole moiety. This compound is typically a white to off-white solid and is soluble in water due to the presence of the carboxylic acid functional group, which can ionize in aqueous solutions. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility. This compound is of interest in medicinal chemistry and pharmacology, often studied for its potential biological activities, including effects on neurotransmitter systems. Its stereochemistry, denoted by the (E) configuration, suggests specific spatial arrangements of its substituents, which can significantly influence its biological interactions. Overall, the compound's unique structural features and functional groups contribute to its reactivity and potential applications in various chemical and pharmaceutical contexts.

Formula: C₈H₁₄ClNO₂

InChI: InChI=1/C8H13NO2.ClH/c10-8(11)7-4-5-2-1-3-6(5)9-7;/h5-7,9H,1-4H2,(H,10,11);1H

SMILES: C1CC2CC(C(=O)O)NC2C1.Cl

Synonyms:

• (2S,3aS,6aS)-Octahydrocyclopenta[b]pyrrole-2-carboxylic acid hydrochloride
• Octahydrocyclopenta[B]Pyrrole-2-Carboxylic Acid Hydrochloride (1:1)

(2s,3As,6as)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid hydrochloride

CAS: 87269-86-1

(2s,3As,6as)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid hydrochloride

Purity: 98%

Ref: 54-OR1040443