CAS 87269-98-5
:Ethyl (αS)-α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxobenzenebutanoate
Description:
Ethyl (αS)-α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxobenzenebutanoate, with CAS number 87269-98-5, is a chemical compound that belongs to the class of amino acid derivatives. It features a complex structure characterized by the presence of an ethyl ester group, a ketone functional group, and a phenylmethoxy moiety, which contributes to its potential biological activity. The compound exhibits chirality, indicated by the presence of multiple stereocenters, which can influence its pharmacological properties and interactions with biological systems. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions, making it important for researchers to consider these factors when studying its behavior in different contexts. Overall, this compound represents a unique entity in the realm of organic chemistry with potential implications in drug design and development.
Formula:C22H25NO5
InChI:InChI=1S/C22H25NO5/c1-3-27-22(26)19(14-20(24)18-12-8-5-9-13-18)23-16(2)21(25)28-15-17-10-6-4-7-11-17/h4-13,16,19,23H,3,14-15H2,1-2H3/t16-,19-/m0/s1
InChI key:InChIKey=UPKXHAFBNBTYBD-LPHOPBHVSA-N
SMILES:[C@@H](CC(=O)C1=CC=CC=C1)(N[C@H](C(OCC2=CC=CC=C2)=O)C)C(OCC)=O
Synonyms:- Benzenebutanoic acid, α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxo-, ethyl ester, (αS)-
- Ethyl (αS)-α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxobenzenebutanoate
- Benzenebutanoic acid, α-[[1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxo-, ethyl ester, [S-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl (S)-2-(((S)-1-(benzyloxy)-1-oxopropan-2-yl)amino)-4-oxo-4-phenylbutanoate
CAS:Controlled ProductFormula:C22H25NO5Color and Shape:NeatMolecular weight:383.438

