CAS 872706-97-3
:4-(chloromethyl)pyridin-2-amine
Description:
4-(Chloromethyl)pyridin-2-amine, with the CAS number 872706-97-3, is an organic compound characterized by a pyridine ring substituted with both a chloromethyl group and an amino group. The presence of the chloromethyl group introduces a reactive site, making it useful in various chemical reactions, such as nucleophilic substitutions. The amino group contributes to the compound's basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity in different solvents. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its applications can range from pharmaceutical intermediates to agrochemical synthesis, depending on the specific reactivity and properties desired. Safety considerations should be taken into account, as the chloromethyl group can pose hazards, including potential toxicity and reactivity. Proper handling and storage conditions are essential to ensure safety when working with this compound.
Formula:C6H7ClN2
InChI:InChI=1/C6H7ClN2/c7-4-5-1-2-9-6(8)3-5/h1-3H,4H2,(H2,8,9)
Synonyms:- 2-Pyridinamine, 4-(Chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
